Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ginsenoside Rd may have properties that inhibit or prevent the growth of tumors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14521 |
|---|---|
| Formula | C48H82O18 |
| Molecular Weight | 947.15 |
| CAS Number | 52705-93-8 |
| SMILES | O[C@H]1[C@@]2([H])[C@](CC[C@]2([H])[C@@](CC/C=C(C)/C)(C)O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)(C)[C@]4(C)CC[C@]5([H])[C@@](CC[C@H](O[C@]6([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O[C@@]7([H])[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O7)C5(C)C)(C)[C@@]4([H])C1 |
| Synonyms | Gypenoside VIII |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (81.29 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.56 mL | 52.79 mL | 105.58 mL |
| 0.5 mM | 2.11 mL | 10.56 mL | 21.12 mL |
| 1 mM | 1.06 mL | 5.28 mL | 10.56 mL |
| 5 mM | 0.21 mL | 1.06 mL | 2.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
