Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GLX351322 is an inhibitor of NADPH oxidase 4 (Nox4), and inhibits hydrogen peroxide production from NOX4-overexpressing cells with an IC50 of 5 μM. |
|---|
| Catalog Num | A20327 |
|---|---|
| Formula | C21H25N3O5S |
| Molecular Weight | 431.51 |
| CAS Number | 835598-94-2 |
| SMILES | O=C(OCC)C1=C(SC2=C1CCC2)NC(CN3CCN(CC3)C(C4=CC=CO4)=O)=O |
| Synonyms | GLX 351322, GLX-351322 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (44.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (9.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.17 mL | 115.87 mL | 231.74 mL |
| 0.5 mM | 4.63 mL | 23.17 mL | 46.35 mL |
| 1 mM | 2.32 mL | 11.59 mL | 23.17 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
