Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK 2334470 is a potent 3-phosphoinositide-dependent protein kinase (PDK1) inhibitor (IC50 ~ 10 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12767 |
|---|---|
| Formula | C25H34N8O |
| Molecular Weight | 462.59 |
| CAS Number | 1227911-45-6 |
| SMILES | C[C@@H]1CC[C@@H](CN1C2=NC(=NC(=C2)C3=CC4=C(C=C3)C(=NN4)N)NC)C(=O)NC5CCCCC5 |
| Synonyms | GSK-2334470, GSK2334470 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (177.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 82 mg/mL (177.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.62 mL | 108.09 mL | 216.17 mL |
| 0.5 mM | 4.32 mL | 21.62 mL | 43.23 mL |
| 1 mM | 2.16 mL | 10.81 mL | 21.62 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
