GW4064
GW4064 is a selective, non-steroidal farnesoid X receptor (FXR) agonist (EC50 = 15 nM).
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | GW4064 is a selective, non-steroidal farnesoid X receptor (FXR) agonist (EC50 = 15 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11141 |
|---|---|
| Formula | C28H22Cl3NO4 |
| Molecular Weight | 542.8 |
| CAS Number | 278779-30-9 |
| SMILES | CC(C)C1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)COC3=CC(=C(C=C3)/C=C/C4=CC(=CC=C4)C(=O)O)Cl |
| Synonyms | GW-4064 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (182.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose | 10 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.42 mL | 92.11 mL | 184.23 mL |
| 0.5 mM | 3.68 mL | 18.42 mL | 36.85 mL |
| 1 mM | 1.84 mL | 9.21 mL | 18.42 mL |
| 5 mM | 0.37 mL | 1.84 mL | 3.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2