Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | H3B-5942 is a selective, irreversible and orally active estrogen receptor covalent antagonist, inactivates both wild-type and mutant ERα by targeting Cys530, with Kis of 1 nM and 0.41 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19960 |
|---|---|
| Formula | C31H34N4O2 |
| Molecular Weight | 494.63 |
| CAS Number | 2052128-15-9 |
| SMILES | CC/C(C1=CC=CC=C1)=C(C2=CC=C(OCCNC/C=C/C(N(C)C)=O)C=C2)\C3=CC(C=NN4)=C4C=C3 |
| Synonyms | H3B5942, H3B 5942 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (177.9 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL (24.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.22 mL | 101.09 mL | 202.17 mL |
| 0.5 mM | 4.04 mL | 20.22 mL | 40.43 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.22 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
