Harpagide
Catalog No.: A14703
Harpagide and harpagoside are two iridoid glycosides existing in many medicinal plants.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Harpagide and harpagoside are two iridoid glycosides existing in many medicinal plants. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A14703 |
|---|---|
| Formula | C15H24O10 |
| Molecular Weight | 364.35 |
| CAS Number | CAS: 6926-08-5 |
| SMILES | CC1(CC(C2(C1C(OC=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (181.14 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.45 mL | 137.23 mL | 274.46 mL |
| 0.5 mM | 5.49 mL | 27.45 mL | 54.89 mL |
| 1 mM | 2.74 mL | 13.72 mL | 27.45 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.49 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2