Harpagoside is an anti-inflammatory small molecule natural product originally isolated from the Harpagophytum procumbens (Devil‘s Claw) root, but can be isolated from other plants such as Crophularia ningpoensis Hemsl (Figwort).
Loading distributor info...
| Description | Harpagoside is an anti-inflammatory small molecule natural product originally isolated from the Harpagophytum procumbens (Devil‘s Claw) root, but can be isolated from other plants such as Crophularia ningpoensis Hemsl (Figwort). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13953 |
|---|---|
| Formula | C24H30O11 |
| Molecular Weight | 494.49 |
| CAS Number | 19210-12-9 |
| SMILES | C[C@@]1(C[C@H]([C@]2([C@@H]1[C@@H](OC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)OC(=O)/C=C/C4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (188.07 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.22 mL | 101.11 mL | 202.23 mL |
| 0.5 mM | 4.04 mL | 20.22 mL | 40.45 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.22 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
