Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HLM006474 is a pan E2F inhibitor, which inhibits E2F4 DNA-binding with an IC50 of 29.8 ?M in A375 cells. |
|---|
| Catalog Num | A20921 |
|---|---|
| Formula | C25H25N3O2 |
| Molecular Weight | 399.48 |
| CAS Number | 353519-63-8 |
| SMILES | OC(C1=NC(C)=CC=C1C=C2)=C2C(NC3=NC=CC=C3)C(C=C4C)=CC=C4OCC |
| Synonyms | HLM 006474, HLM-006474 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (22.53 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.03 mL | 125.16 mL | 250.33 mL |
| 0.5 mM | 5.01 mL | 25.03 mL | 50.07 mL |
| 1 mM | 2.5 mL | 12.52 mL | 25.03 mL |
| 5 mM | 0.5 mL | 2.5 mL | 5.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
