Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HSF1A is a cell-permeable activator of heat shock transcription factor 1 (HSF1). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17147 |
|---|---|
| Formula | C21H19N3O2S2 |
| Molecular Weight | 409.52 |
| CAS Number | 1196723-93-9 |
| SMILES | CCC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=NN2C3=CC=CC=C3)C4=CC=CS4 |
| Synonyms | HSF1 A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (173.37 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (41.51 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.42 mL | 122.09 mL | 244.19 mL |
| 0.5 mM | 4.88 mL | 24.42 mL | 48.84 mL |
| 1 mM | 2.44 mL | 12.21 mL | 24.42 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
