Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HTHQ, which is a hydroquinone monoalkyl ether, is a potent anti-oxidative agent, even at low dose levels. |
|---|
| Catalog Num | A16335 |
|---|---|
| Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Number | 148081-72-5 |
| SMILES | CCCCCCOC1=C(C(=C(C(=C1)C)O)C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (177.7 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.31 mL | 211.55 mL | 423.1 mL |
| 0.5 mM | 8.46 mL | 42.31 mL | 84.62 mL |
| 1 mM | 4.23 mL | 21.16 mL | 42.31 mL |
| 5 mM | 0.85 mL | 4.23 mL | 8.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
