IBR2
Catalog No.: A19739
RAD51 inhibitor
IBR2 is a specific RAD51 inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | IBR2 is a specific RAD51 inhibitor. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19739 |
|---|---|
| Formula | C24H20N2O2S |
| Molecular Weight | 400.49 |
| CAS Number | 313526-24-8 |
| SMILES | O=S(N1C(C2=CNC3=C2C=CC=C3)C4=C(C=CC=C4)C=C1)(CC5=CC=CC=C5)=O |
| Synonyms | IBR-2, IBR 2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2