Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ICA-069673 is a KCNQ2/Q3 potassium channel activator with an IC50 of 0.69 μM. |
|---|
| Catalog Num | A20576 |
|---|---|
| Formula | C11H6ClF2N3O |
| Molecular Weight | 269.63 |
| CAS Number | 582323-16-8 |
| SMILES | O=C(NC1=CN=C(Cl)N=C1)C2=CC=C(F)C(F)=C2 |
| Synonyms | ICA069673, ICA 069673 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (196.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 53 mg/mL (196.56 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.09 mL | 185.44 mL | 370.88 mL |
| 0.5 mM | 7.42 mL | 37.09 mL | 74.18 mL |
| 1 mM | 3.71 mL | 18.54 mL | 37.09 mL |
| 5 mM | 0.74 mL | 3.71 mL | 7.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
