Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | ICI-118551 is a selective beta2 adrenergic receptor (adrenoreceptor) antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15878 |
|---|---|
| Formula | C17H27NO2.HCl |
| Molecular Weight | 313.86 |
| CAS Number | 1217094-53-5 |
| SMILES | CC1=C(CCC2)C2=C(OC[C@H](O)[C@@H](C)NC(C)C)C=C1.Cl |
| Synonyms | ICI118551, ICI 118551 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (187.98 mM) | |
| Water | 20 mg/mL (63.71 mM) | ||
| Ethanol | 59 mg/mL (187.98 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.86 mL | 159.31 mL | 318.61 mL |
| 0.5 mM | 6.37 mL | 31.86 mL | 63.72 mL |
| 1 mM | 3.19 mL | 15.93 mL | 31.86 mL |
| 5 mM | 0.64 mL | 3.19 mL | 6.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
