Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IDO-IN-1 is a potent indoleamine 2,3-dioxygenase (IDO) inhibitor with an IC50 of 59 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20523 |
|---|---|
| Formula | C9H7BrFN5O2 |
| Molecular Weight | 316.09 |
| CAS Number | 914638-30-5 |
| SMILES | NC1=NON=C1/C(NO)=N/C2=CC(Br)=C(F)C=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (180.33 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (180.33 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.64 mL | 158.18 mL | 316.37 mL |
| 0.5 mM | 6.33 mL | 31.64 mL | 63.27 mL |
| 1 mM | 3.16 mL | 15.82 mL | 31.64 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
