Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Imiquimod (Aldara) is a a heterocyclic imidazoquinoline amide that acts as an immune response modifier. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10469 |
|---|---|
| Formula | C14H16N4 |
| Molecular Weight | 240.3 |
| CAS Number | 99011-02-6 |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Synonyms | Aldara |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 1 mg/mL (4.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.61 mL | 208.07 mL | 416.15 mL |
| 0.5 mM | 8.32 mL | 41.61 mL | 83.23 mL |
| 1 mM | 4.16 mL | 20.81 mL | 41.61 mL |
| 5 mM | 0.83 mL | 4.16 mL | 8.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
