Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Importazole is a cell-permeable inhibitor of importin-β. It specifically inhibits the function of importin-β, likely by altering its interaction with RanGTP. |
|---|
| Catalog Num | A17128 |
|---|---|
| Formula | C20H22N4 |
| Molecular Weight | 318.4 |
| CAS Number | 662163-81-7 |
| SMILES | [H]N(C(C1=CC=CC=C1)C)C2=NC(N3CCCC3)=NC4=C2C=CC=C4 |
| Synonyms | IPZ |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (182.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 29 mg/mL (91.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.41 mL | 157.04 mL | 314.07 mL |
| 0.5 mM | 6.28 mL | 31.41 mL | 62.81 mL |
| 1 mM | 3.14 mL | 15.7 mL | 31.41 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
