Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | INCB-057643 is a novel, orally bioavailable BET inhibitor. |
|---|
| Catalog Num | A19737 |
|---|---|
| Formula | C20H21N3O5S |
| Molecular Weight | 415.46 |
| CAS Number | 1820889-23-3 |
| SMILES | O=C1C(C)(C)OC2=C(C3=CN(C)C(C4=C3C=CN4)=O)C=C(S(=O)(C)=O)C=C2N1C |
| Synonyms | INCB 057643, INCB057643 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (170.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.07 mL | 120.35 mL | 240.7 mL |
| 0.5 mM | 4.81 mL | 24.07 mL | 48.14 mL |
| 1 mM | 2.41 mL | 12.03 mL | 24.07 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
