Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Indoximod is a methylated tryptophan with anti-immunosuppressive activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14397 |
|---|---|
| Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Number | 110117-83-4 |
| SMILES | CN1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)N |
| Synonyms | NLG8189, NLG 8189, NLG-8189, D-1MT |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 1 mg/mL (4.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+5% Tween 80+ddH2O | 0.1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.82 mL | 229.1 mL | 458.19 mL |
| 0.5 mM | 9.16 mL | 45.82 mL | 91.64 mL |
| 1 mM | 4.58 mL | 22.91 mL | 45.82 mL |
| 5 mM | 0.92 mL | 4.58 mL | 9.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
