Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | INK 128 is a TORC1/2 inhibitor, is also an orally bioavailable inhibitor of raptor-mTOR (TOR complex 1 or TORC1) and rictor-mTOR (TOR complex 2 or TORC2) with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11461 |
|---|---|
| Formula | C15H15N7O |
| Molecular Weight | 309.3 |
| CAS Number | 1224844-38-5 |
| SMILES | CC(C)N1C2=C(C(=N1)C3=CC4=C(C=C3)OC(=N4)N)C(=NC=N2)N |
| Synonyms | INK128, INK-128 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (187.5 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.46 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.33 mL | 161.66 mL | 323.31 mL |
| 0.5 mM | 6.47 mL | 32.33 mL | 64.66 mL |
| 1 mM | 3.23 mL | 16.17 mL | 32.33 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
