Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Iopamidol is a non-ionic, water-soluble radiographic contrast agent. |
|---|
| Catalog Num | A16009 |
|---|---|
| Formula | C17H22I3N3O8 |
| Molecular Weight | 777.09 |
| CAS Number | 60166-93-0 |
| SMILES | CC(C(=O)NC1=C(C(=C(C(=C1I)C(=O)NC(CO)CO)I)C(=O)NC(CO)CO)I)O |
| Synonyms | Iopamiro, Isovue, Iopamiron, Niopam |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (123.53 mM) | |
| Water | 96 mg/mL (123.53 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.87 mL | 64.34 mL | 128.69 mL |
| 0.5 mM | 2.57 mL | 12.87 mL | 25.74 mL |
| 1 mM | 1.29 mL | 6.43 mL | 12.87 mL |
| 5 mM | 0.26 mL | 1.29 mL | 2.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
