Loading distributor info...
| Description | Irosustat is a potent steroid sulfatase inhibitor, with an IC50 of 8 nM, and exhibits anti-breast cancer activity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21287 |
|---|---|
| Formula | C14H15NO5S |
| Molecular Weight | 309.34 |
| CAS Number | 288628-05-7 |
| SMILES | O=C1OC2=CC(OS(=O)(N)=O)=CC=C2C3=C1CCCCC3 |
| Synonyms | STX64; BN83495; 667-Coumate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (187.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (45.26 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.33 mL | 161.63 mL | 323.27 mL |
| 0.5 mM | 6.47 mL | 32.33 mL | 64.65 mL |
| 1 mM | 3.23 mL | 16.16 mL | 32.33 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
