Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Isoimperatorin is an anti-inflammatory agent, that also has an effect on proliferation, isolated from the dried roots of Angelicae dahuricae. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14550 |
|---|---|
| Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Number | 482-45-1 |
| SMILES | CC(=CCOC1=C2C=CC(=O)OC2=CC3=C1C=CO3)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (192.39 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37 mL | 184.99 mL | 369.99 mL |
| 0.5 mM | 7.4 mL | 37 mL | 74 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
