Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Itraconazole is a relatively potent inhibitor of CYP3A4 with IC50 of 6.1 nM, used as a triazole antifungal agent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10489 |
|---|---|
| Formula | C35H38Cl2N8O4 |
| Molecular Weight | 705.65 |
| CAS Number | 84625-61-6 |
| SMILES | CCC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)OC[C@H]5CO[C@](O5)(CN6C=NC=N6)C7=C(C=C(C=C7)Cl)Cl |
| Synonyms | Sporanox |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 7 mg/mL (9.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40% PEG 300+10% Tween 80+45% ddH2O | 1.66 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.17 mL | 70.86 mL | 141.71 mL |
| 0.5 mM | 2.83 mL | 14.17 mL | 28.34 mL |
| 1 mM | 1.42 mL | 7.09 mL | 14.17 mL |
| 5 mM | 0.28 mL | 1.42 mL | 2.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
