Loading distributor info...
| Description | IWP-O1 is a porcn inhibitor with an EC50 value of 80 pM in a cultured cell reporter assay of Wnt signaling and effectively suppresses the phosphorylation of Dvl2/3 in HeLa cells. |
|---|
| Catalog Num | A16846 |
|---|---|
| Formula | C26H20N6O |
| Molecular Weight | 432.48 |
| CAS Number | 2074607-48-8 |
| SMILES | O=C(NC1=NC=C(C2=CC=CC=C2)C=C1)CN3N=NC(C4=CC=NC=C4)=C3C5=CC=CC=C5 |
| Synonyms | IWPO1, IWP O1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (182.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 79 mg/mL (182.66 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.12 mL | 115.61 mL | 231.22 mL |
| 0.5 mM | 4.62 mL | 23.12 mL | 46.24 mL |
| 1 mM | 2.31 mL | 11.56 mL | 23.12 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
