Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JIB-04 is a pan-selective Jumonji histone demethylase inhibitor with IC50 of 230, 340, 855, 445, 435, 1100, and 290 nM for JARID1A, JMJD2E, JMJD3, JMJD2A, JMJD2B, JMJD2C, and JMJD2D, respectively. |
|---|
| Catalog Num | A13806 |
|---|---|
| Formula | C17H13ClN4 |
| Molecular Weight | 308.76 |
| CAS Number | 199596-05-9 |
| SMILES | C1=CC=C(C=C1)/C(=N\NC2=NC=C(C=C2)Cl)/C3=CC=CC=N3 |
| Synonyms | NSC 693627, JIB04 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 22 mg/mL (71.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+corn oil | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.39 mL | 161.94 mL | 323.88 mL |
| 0.5 mM | 6.48 mL | 32.39 mL | 64.78 mL |
| 1 mM | 3.24 mL | 16.19 mL | 32.39 mL |
| 5 mM | 0.65 mL | 3.24 mL | 6.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
