Loading distributor info...
| Description | JNJ 1661010 is a selective and reversible inhibitor of fatty acid amide hydrolase (FAAH) (IC50 = 12nM). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12420 |
|---|---|
| Formula | C19H19N5OS |
| Molecular Weight | 365.45 |
| CAS Number | 681136-29-8 |
| SMILES | C1CN(CCN1C2=NC(=NS2)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 35 mg/mL (95.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+95% Corn oil | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.36 mL | 136.82 mL | 273.64 mL |
| 0.5 mM | 5.47 mL | 27.36 mL | 54.73 mL |
| 1 mM | 2.74 mL | 13.68 mL | 27.36 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
