Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | JNJ-26854165 is one of p53-activating agents and synergizes with AraC or doxorubicin to induce p53-mediated apoptosis and may provide a novel therapeutic approach for the treatment of acute leukemias. |
|---|
| Catalog Num | A10491 |
|---|---|
| Formula | C21H20N4 |
| Molecular Weight | 328.4 |
| CAS Number | 881202-45-5 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC3=CC=C(C=C3)NC4=CC=NC=C4 |
| Synonyms | JNJ26854165 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 56 mg/mL (170.51 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.08 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.45 mL | 152.25 mL | 304.51 mL |
| 0.5 mM | 6.09 mL | 30.45 mL | 60.9 mL |
| 1 mM | 3.05 mL | 15.23 mL | 30.45 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
