Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | K-Ras(G12C) inhibitor 6 is an irreversible inhibitor of oncogenic K-Ras(G12C), subverting the native nucleotide preference to favour GDP over GTP. |
|---|
| Catalog Num | A14103 |
|---|---|
| Formula | C17H22Cl2N2O3S |
| Molecular Weight | 405.34 |
| CAS Number | 2060530-16-5 |
| SMILES | C1CN(CCC1NC(=O)CCCS)C(=O)COC2=C(C=C(C=C2)Cl)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (185.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 28 mg/mL (69.08 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.67 mL | 123.35 mL | 246.71 mL |
| 0.5 mM | 4.93 mL | 24.67 mL | 49.34 mL |
| 1 mM | 2.47 mL | 12.34 mL | 24.67 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
