Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | As an antifungal, ketoconazole is structurally similar to imidazole, and interferes with the fungal synthesis of ergosterol, a constituent of fungal cell membranes, as well as certain enzymes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10498 |
|---|---|
| Formula | C26H28Cl2N4O4 |
| Molecular Weight | 531.4 |
| CAS Number | 65277-42-1 |
| SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OC[C@H]3CO[C@](O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl |
| Synonyms | Nizoral, Extina, Xolegel, Kuric |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 5 mg/mL (9.4 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.82 mL | 94.09 mL | 188.18 mL |
| 0.5 mM | 3.76 mL | 18.82 mL | 37.64 mL |
| 1 mM | 1.88 mL | 9.41 mL | 18.82 mL |
| 5 mM | 0.38 mL | 1.88 mL | 3.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
