Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KY02111 is a potent and selective Wnt signaling pathway inhibitor discovered by a cell-based screening, which promotes differentiation of hESCs/iPSCs to cardiomyocytes when used at the second stage of differenitation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12362 |
|---|---|
| Formula | C18H17ClN2O3S |
| Molecular Weight | 376.86 |
| CAS Number | 1118807-13-8 |
| SMILES | COC1=C(C=C(C=C1)CCC(=O)NC2=NC3=C(S2)C=C(C=C3)Cl)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (185.74 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.54 mL | 132.68 mL | 265.35 mL |
| 0.5 mM | 5.31 mL | 26.54 mL | 53.07 mL |
| 1 mM | 2.65 mL | 13.27 mL | 26.54 mL |
| 5 mM | 0.53 mL | 2.65 mL | 5.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
