Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lasofoxifene tartrate is a third-generation selective estrogen receptor modulator. |
|---|
| Catalog Num | A18097 |
|---|---|
| Formula | C28H31NO2 |
| Molecular Weight | 413.56 |
| CAS Number | 190791-29-8 |
| SMILES | OC1=CC=C2[C@@H](C3=CC=C(OCCN4CCCC4)C=C3)[C@@H](C5=CC=CC=C5)CCC2=C1 |
| Synonyms | Lasofoxifene tartrate; Fablyn; CP-336156; CP 336156; CP336156; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (163.22 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.18 mL | 120.9 mL | 241.8 mL |
| 0.5 mM | 4.84 mL | 24.18 mL | 48.36 mL |
| 1 mM | 2.42 mL | 12.09 mL | 24.18 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
