Lathyrol
Catalog No.: A12082
Lathyrol is a natural product, and is used for cancer treatment.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Lathyrol is a natural product, and is used for cancer treatment. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12082 |
|---|---|
| Formula | C20H30O4 |
| Molecular Weight | 334.45 |
| CAS Number | 34420-19-4 |
| SMILES | C[C@H]1C[C@]2([C@H]([C@H]1O)[C@@H](C(=C)CC[C@H]3[C@H](C3(C)C)/C=C(/C2=O)\C)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (218.26 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.9 mL | 149.5 mL | 299 mL |
| 0.5 mM | 5.98 mL | 29.9 mL | 59.8 mL |
| 1 mM | 2.99 mL | 14.95 mL | 29.9 mL |
| 5 mM | 0.6 mL | 2.99 mL | 5.98 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2