Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LDE225 (NVP-LDE225) is a potent, selective and orally bioavailable Smoothened (SMO) antagonist that inhibits hedgehog (Hh) signaling pathway via antagonism of the Smoothened receptor (SMO). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10520 |
|---|---|
| Formula | C26H26F3N3O3 |
| Molecular Weight | 485.5 |
| CAS Number | 956697-53-3 |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=NC=C(C=C2)NC(=O)C3=CC=CC(=C3C)C4=CC=C(C=C4)OC(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 82 mg/mL (168.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 82 mg/mL (168.89 mM) | ||
| In vivo | 2% DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.6 mL | 102.99 mL | 205.97 mL |
| 0.5 mM | 4.12 mL | 20.6 mL | 41.19 mL |
| 1 mM | 2.06 mL | 10.3 mL | 20.6 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
