Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LEE011 is an orally available cyclin-dependent kinase (CDK) inhibitor targeting cyclin D1/CDK4 and cyclin D3/CDK6 cell cycle pathway, with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13549 |
|---|---|
| Formula | C23H30N8O |
| Molecular Weight | 434.54 |
| CAS Number | 1211441-98-3 |
| SMILES | CN(C)C(=O)C1=CC2=CN=C(N=C2N1C3CCCC3)NC4=NC=C(C=C4)N5CCNCC5 |
| Synonyms | LEE-011, LEE 011 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (16.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.01 mL | 115.06 mL | 230.13 mL |
| 0.5 mM | 4.6 mL | 23.01 mL | 46.03 mL |
| 1 mM | 2.3 mL | 11.51 mL | 23.01 mL |
| 5 mM | 0.46 mL | 2.3 mL | 4.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
