Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Letrozole is an Aromatase inhibitor. CGS 20267 is a new non-steroidal compound which potently inhibits aromatase in vitro (IC50 of 11.5 nM) and in vivo (ED50 of 1?€?3 μg/kg p.o.) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10523 |
|---|---|
| Formula | C17H11N5 |
| Molecular Weight | 285.3 |
| CAS Number | 112809-51-5 |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3C=NC=N3 |
| Synonyms | CGS 20267, Femara, Piroxicam |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 50 mg/mL (175.25 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC Na | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.05 mL | 175.25 mL | 350.51 mL |
| 0.5 mM | 7.01 mL | 35.05 mL | 70.1 mL |
| 1 mM | 3.51 mL | 17.53 mL | 35.05 mL |
| 5 mM | 0.7 mL | 3.51 mL | 7.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
