Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LGK974 is a highly potent, selective and orally bioavailable Porcupine inhibitor (Wnt signaling antagonist) with an IC50 <1 nM in the Wnt signaling reporter assay and Porcupine binding assay. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12816 |
|---|---|
| Formula | C23H20N6O |
| Molecular Weight | 396.44 |
| CAS Number | 1243244-14-5 |
| SMILES | CC1=C(N=CC(=C1)CC(=O)NC2=NC=C(C=C2)C3=NC=CN=C3)C4=CC(=NC=C4)C |
| Synonyms | LGK974, LGK 974 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 76 mg/mL (191.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+corn oil | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.22 mL | 126.12 mL | 252.24 mL |
| 0.5 mM | 5.04 mL | 25.22 mL | 50.45 mL |
| 1 mM | 2.52 mL | 12.61 mL | 25.22 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
