Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lidocaine (Alphacaine) is an anasthetic and class Ib antiarrhythmic agent. Blocks voltage-gated sodium channels in the inactivated state. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10530 |
|---|---|
| Formula | C14H22N2O |
| Molecular Weight | 234.34 |
| CAS Number | 137-58-6 |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (200.56 mM) | |
| Water | 9 mg/mL (38.4 mM) | ||
| Ethanol | 47 mg/mL (200.56 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.67 mL | 213.37 mL | 426.73 mL |
| 0.5 mM | 8.53 mL | 42.67 mL | 85.35 mL |
| 1 mM | 4.27 mL | 21.34 mL | 42.67 mL |
| 5 mM | 0.85 mL | 4.27 mL | 8.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
