Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Liriope muscari baily saponins C, extracted from dried root tuber of Liliaceae Liriope. |
|---|
| Catalog Num | A14764 |
|---|---|
| Formula | C44H70O16 |
| Molecular Weight | 855.02 |
| CAS Number | 87480-46-4 |
| SMILES | C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)OC1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (102.92 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.7 mL | 58.48 mL | 116.96 mL |
| 0.5 mM | 2.34 mL | 11.7 mL | 23.39 mL |
| 1 mM | 1.17 mL | 5.85 mL | 11.7 mL |
| 5 mM | 0.23 mL | 1.17 mL | 2.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
