Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Lithospermic acid was extracted from Labiatae Salvia miltiorrhiza Bge. dried roots. |
|---|
| Catalog Num | A14660 |
|---|---|
| Formula | C27H22O12 |
| Molecular Weight | 538.46 |
| CAS Number | 28831-65-4 |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (167.14 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.57 mL | 92.86 mL | 185.71 mL |
| 0.5 mM | 3.71 mL | 18.57 mL | 37.14 mL |
| 1 mM | 1.86 mL | 9.29 mL | 18.57 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
