Loading distributor info...
| Description | Lodoxamide Tromethamide is a mast-cell stabilizer, inhibiting type I immediate hypersensitivity reaction by preventing the antigen-stimulated calcium influx into mast cells and the release of slow-reacting substances of anaphylaxis (SRS-A). |
|---|
| Catalog Num | A17969 |
|---|---|
| Formula | C15H17ClN4O9 |
| Molecular Weight | 432.77 |
| CAS Number | 63610-09-3 |
| SMILES | OCC(CO)(N)CO.O=C(O)C(NC1=CC(C#N)=CC(NC(C(O)=O)=O)=C1Cl)=O |
| Synonyms | Lodoxamide Tromethamide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 18 mg/mL (32.49 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.11 mL | 115.53 mL | 231.07 mL |
| 0.5 mM | 4.62 mL | 23.11 mL | 46.21 mL |
| 1 mM | 2.31 mL | 11.55 mL | 23.11 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
