Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Loganic acid, extracted from Gentiana macrophylla Pall root and rhizome. |
|---|
| Catalog Num | A14778 |
|---|---|
| Formula | C16H24O10 |
| Molecular Weight | 376.36 |
| CAS Number | 22255-40-9 |
| SMILES | CC1C(CC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)CO)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (193.96 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.57 mL | 132.85 mL | 265.7 mL |
| 0.5 mM | 5.31 mL | 26.57 mL | 53.14 mL |
| 1 mM | 2.66 mL | 13.29 mL | 26.57 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
