Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lupeol is a dietary triterpene found in certain fruits, vegetables, and medicinal plants. It has potent anti-inflammatory, anticarcinogenic, antimutagenic, and antimalarial activity. |
|---|
| Catalog Num | A13951 |
|---|---|
| Formula | C30H50O |
| Molecular Weight | 426.7 |
| CAS Number | 545-47-1 |
| SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4(C3(CC2)C)C)(C)C)O)C)C |
| Synonyms | Clerodol, Lupenol, ??-Viscol, Monogynol B, NSC 90487, Fagarasterol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.44 mL | 117.18 mL | 234.36 mL |
| 0.5 mM | 4.69 mL | 23.44 mL | 46.87 mL |
| 1 mM | 2.34 mL | 11.72 mL | 23.44 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
