Loading distributor info...
| Description | Lusutrombopag, also known as S-888711, is an orally bioavailable, small molecule thrombopoietin (TPO) receptor agonist being developed by Shionogi for chronic liver disease (CLD) patients with thrombocytopenia prior to elective invasive surgery. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18089 |
|---|---|
| Formula | C29H32Cl2N2O5S |
| Molecular Weight | 591.54 |
| CAS Number | 1110766-97-6 |
| SMILES | O=C(O)/C(C)=C/C1=C(Cl)C=C(C(NC2=NC(C3=CC=CC([C@@H](OCCCCCC)C)=C3OC)=CS2)=O)C=C1Cl |
| Synonyms | S-888711; S 888711; S888711; Lusutrombopag, brand name: Mulpleta. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (160.59 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.91 mL | 84.53 mL | 169.05 mL |
| 0.5 mM | 3.38 mL | 16.91 mL | 33.81 mL |
| 1 mM | 1.69 mL | 8.45 mL | 16.91 mL |
| 5 mM | 0.34 mL | 1.69 mL | 3.38 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
