Loading distributor info...
| Description | LY-2584702 tosylate salt is an orally available inhibitor of p70S6K signaling; inhibits p70S6K and prevents phosphorylation of the S6 subunit of ribosomes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15527 |
|---|---|
| Formula | C28H27F4N7O3S |
| Molecular Weight | 617.62 |
| CAS Number | 1082949-68-5 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1C=C(N=C1C2CCN(CC2)C3=NC=NC4=C3C=NN4)C5=CC(=C(C=C5)F)C(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 7 mg/mL (11.33 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.19 mL | 80.96 mL | 161.91 mL |
| 0.5 mM | 3.24 mL | 16.19 mL | 32.38 mL |
| 1 mM | 1.62 mL | 8.1 mL | 16.19 mL |
| 5 mM | 0.32 mL | 1.62 mL | 3.24 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
