Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2835219 is a potent and selective inhibitor of CDK4 and CDK6 with IC50 of 2 nM and 10 nM in cell-free assays, respectively. Phase 3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16386 |
|---|---|
| Formula | C27H32F2N8.CH4O3S |
| Molecular Weight | 602.7 |
| CAS Number | 1231930-82-7 |
| SMILES | CCN1CCN(CC1)CC2=CN=C(C=C2)NC3=NC=C(C(=N3)C4=CC5=C(C(=C4)F)N=C(N5C(C)C)C)F.CS(=O)(=O)O |
| Synonyms | Abemaciclib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 81 mg/mL (134.39 mM) | |
| Water | 97 mg/mL (160.94 mM) | ||
| Ethanol | 23 mg/mL | ||
| In vivo | water | 95 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.59 mL | 82.96 mL | 165.92 mL |
| 0.5 mM | 3.32 mL | 16.59 mL | 33.18 mL |
| 1 mM | 1.66 mL | 8.3 mL | 16.59 mL |
| 5 mM | 0.33 mL | 1.66 mL | 3.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
