Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY3009120 is a pan RAF inhibitor which inhibits BRAFV600E, BRAFWT and CRAFWT with IC50s of 5.8, 9.1 and 15 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16603 |
|---|---|
| Formula | C23H29FN6O |
| Molecular Weight | 424.51 |
| CAS Number | 1454682-72-4 |
| SMILES | O=C(NC1=CC(C2=CC3=CN=C(NC)N=C3N=C2C)=C(C)C=C1F)NCCC(C)(C)C |
| Synonyms | DP-4978 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 3 mg/mL (7.06 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.56 mL | 117.78 mL | 235.57 mL |
| 0.5 mM | 4.71 mL | 23.56 mL | 47.11 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.56 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
