Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lycopene is an open chain unsaturated carotenoid that gives tomatoes, guava, rose hip, watermelon and pink grapefruit its red color. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14783 |
|---|---|
| Formula | C40H56 |
| Molecular Weight | 536.87 |
| CAS Number | 502-65-8 |
| SMILES | CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C |
| Synonyms | all-trans-Lycopene, Lycopene 7, Psi,psi-carotene, trans-Lycopene, prolycopene |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.63 mL | 93.13 mL | 186.26 mL |
| 0.5 mM | 3.73 mL | 18.63 mL | 37.25 mL |
| 1 mM | 1.86 mL | 9.31 mL | 18.63 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
