Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Madecassic acid has anti-inflammatory effects via the suppression of NF-kappaB pathway in LPS-induced RAW 264.7 macrophage cells | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12086 |
|---|---|
| Formula | C30H48O6 |
| Molecular Weight | 504.71 |
| CAS Number | 18449-41-7 |
| SMILES | OC[C@]1(C)[C@@H](O)[C@H](O)C[C@@]2(C)[C@@]1([H])[C@H](O)C[C@]3(C)[C@]2([H])CC=C4[C@@]3(C)CC[C@]5(C(O)=O)[C@@]4([H])[C@@H](C)[C@H](C)CC5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (174.35 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.81 mL | 99.07 mL | 198.13 mL |
| 0.5 mM | 3.96 mL | 19.81 mL | 39.63 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.81 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
