Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Madrasin is a potent and cell penetrant splicing inhibitor that interferes with the early stages of spliceosome assembly. |
|---|
| Catalog Num | A16063 |
|---|---|
| Formula | C16H17N5O2 |
| Molecular Weight | 311.34 |
| CAS Number | 374913-63-0 |
| SMILES | COC(C=C1)=CC2=C1C(C)=NC(NC3=NC(C(C)=C(C)N3)=O)=N2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (3.21 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (9.63 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.12 mL | 160.6 mL | 321.19 mL |
| 0.5 mM | 6.42 mL | 32.12 mL | 64.24 mL |
| 1 mM | 3.21 mL | 16.06 mL | 32.12 mL |
| 5 mM | 0.64 mL | 3.21 mL | 6.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
