Malic acid disodium salt is a biochemical assay reagent that functions primarily as a buffering agent. It plays a significant role in enhancing flavor, improving texture, and regulating acidity in various applications. Additionally, it serves as a dietary supplement, with research indicating potential benefits such as enhanced energy production, reduced fatigue, and improved athletic performance. This compound is valuable in studies focused on metabolic processes and nutritional science.
Malic acid disodium salt is a biochemical assay reagent that functions primarily as a buffering agent. It plays a significant role in enhancing flavor, improving texture, and regulating acidity in various applications. Additionally, it serves as a dietary supplement, with research indicating potential benefits such as enhanced energy production, reduced fatigue, and improved athletic performance. This compound is valuable in studies focused on metabolic processes and nutritional science.
Product Information
Catalog Num
A86925
Formula
C4H4Na2O5
Molecular Weight
178.05
CAS Number
676-46-0
SMILES
O=C(CC(C(O[Na])=O)O)O[Na]
Synonyms
Hydroxybutanedioic acid disodium salt; E 296 disodium salt
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
